C16H17BrN2O3S — CID 126014838
(5Z)-5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126014838) has the molecular formula C16H17BrN2O3S and a molecular weight of 397.29 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126014838 |
| Molecular Formula | C16H17BrN2O3S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | (5Z)-5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | C=CCOc1c(Br)cc(/C=C2\NC(=S)N(CC)C2=O)cc1OC |
| InChI | InChI=1S/C16H17BrN2O3S/c1-4-6-22-14-11(17)7-10(9-13(14)21-3)8-12-15(20)19(5-2)16(23)18-12/h4,7-9H,1,5-6H2,2-3H3,(H,18,23)/b12-8- |
| InChIKey | XCGBXVXZWZUIPJ-WQLSENKSSA-N |
| XLogP | 3.10 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_I(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|