C22H21BrN2O4S — CID 3862982
5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-3-(4-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 3862982) has the molecular formula C22H21BrN2O4S and a molecular weight of 489.39 g/mol. Its IUPAC name is 5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-3-(4-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-3-(4-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 3862982 |
| Molecular Formula | C22H21BrN2O4S |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | 5-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-3-(4-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | C=CCOc1c(Br)cc(C=C2NC(=S)N(c3ccc(OCC)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C22H21BrN2O4S/c1-4-10-29-20-17(23)11-14(13-19(20)27-3)12-18-21(26)25(22(30)24-18)15-6-8-16(9-7-15)28-5-2/h4,6-9,11-13H,1,5,10H2,2-3H3,(H,24,30) |
| InChIKey | QPUSODUFUXJGOC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|