C15H17BrN2O3S — CID 8023308
(5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-butyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 8023308) has the molecular formula C15H17BrN2O3S and a molecular weight of 385.28 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-butyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-butyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 8023308 |
| Molecular Formula | C15H17BrN2O3S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-butyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCCCN1C(=O)/C(=C\c2cc(Br)c(O)c(OC)c2)NC1=S |
| InChI | InChI=1S/C15H17BrN2O3S/c1-3-4-5-18-14(20)11(17-15(18)22)7-9-6-10(16)13(19)12(8-9)21-2/h6-8,19H,3-5H2,1-2H3,(H,17,22)/b11-7+ |
| InChIKey | JEKLSNNUZILJSE-YRNVUSSQSA-N |
| XLogP | 3.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_I(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|