C16H17BrN2O5 — CID 19579538
5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 19579538) has the molecular formula C16H17BrN2O5 and a molecular weight of 397.23 g/mol. Its IUPAC name is 5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 19579538 |
| Molecular Formula | C16H17BrN2O5 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)C(=Cc2cc(Br)c(O)c(OC)c2)C(=O)N(CC)C1=O |
| InChI | InChI=1S/C16H17BrN2O5/c1-4-18-14(21)10(15(22)19(5-2)16(18)23)6-9-7-11(17)13(20)12(8-9)24-3/h6-8,20H,4-5H2,1-3H3 |
| InChIKey | LLEPYYNSQSCJNS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|