C12H10BrNO4 — CID 135637395
(4E)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-methyl-1,2-oxazol-5-one (PubChem CID 135637395) has the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. Its IUPAC name is (4E)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-methyl-1,2-oxazol-5-one.
| Compound Name | (4E)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-methyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 135637395 |
| Molecular Formula | C12H10BrNO4 |
| Molecular Weight | 312.12 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | (4E)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-methyl-1,2-oxazol-5-one |
| SMILES | COc1cc(/C=C2/C(=O)ON=C2C)cc(Br)c1O |
| InChI | InChI=1S/C12H10BrNO4/c1-6-8(12(16)18-14-6)3-7-4-9(13)11(15)10(5-7)17-2/h3-5,15H,1-2H3/b8-3+ |
| InChIKey | YJSWZTVNYOURFQ-FPYGCLRLSA-N |
| XLogP | 2.48 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.12 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|