C16H18BrNO4 — CID 99889660
(4E)-4-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-3-methyl-1,2-oxazol-5-one (PubChem CID 99889660) has the molecular formula C16H18BrNO4 and a molecular weight of 368.23 g/mol. Its IUPAC name is (4E)-4-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-3-methyl-1,2-oxazol-5-one.
| Compound Name | (4E)-4-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-3-methyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 99889660 |
| Molecular Formula | C16H18BrNO4 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | (4E)-4-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-3-methyl-1,2-oxazol-5-one |
| SMILES | CCCOc1c(Br)cc(/C=C2/C(=O)ON=C2C)cc1OCC |
| InChI | InChI=1S/C16H18BrNO4/c1-4-6-21-15-13(17)8-11(9-14(15)20-5-2)7-12-10(3)18-22-16(12)19/h7-9H,4-6H2,1-3H3/b12-7+ |
| InChIKey | LKLKBYNPNIZTIX-KPKJPENVSA-N |
| XLogP | 3.95 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|