C13H11Br2NO3 — CID 126099457
(4Z)-4-[(3,5-dibromo-2-ethoxyphenyl)methylidene]-3-methyl-1,2-oxazol-5-one (PubChem CID 126099457) has the molecular formula C13H11Br2NO3 and a molecular weight of 389.04 g/mol. Its IUPAC name is (4Z)-4-[(3,5-dibromo-2-ethoxyphenyl)methylidene]-3-methyl-1,2-oxazol-5-one.
| Compound Name | (4Z)-4-[(3,5-dibromo-2-ethoxyphenyl)methylidene]-3-methyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 126099457 |
| Molecular Formula | C13H11Br2NO3 |
| Molecular Weight | 389.04 g/mol |
| Exact Mass | 386.91 |
| IUPAC Name | (4Z)-4-[(3,5-dibromo-2-ethoxyphenyl)methylidene]-3-methyl-1,2-oxazol-5-one |
| SMILES | CCOc1c(Br)cc(Br)cc1/C=C1\C(=O)ON=C1C |
| InChI | InChI=1S/C13H11Br2NO3/c1-3-18-12-8(4-9(14)6-11(12)15)5-10-7(2)16-19-13(10)17/h4-6H,3H2,1-2H3/b10-5- |
| InChIKey | XKVJWLTUWUCMMF-YHYXMXQVSA-N |
| XLogP | 3.93 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.04 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|