C10H8Br4O — CID 130532004
1,5-dibromo-3-(2,2-dibromoethenyl)-2-ethoxybenzene (PubChem CID 130532004) has the molecular formula C10H8Br4O and a molecular weight of 463.79 g/mol. Its IUPAC name is 1,5-dibromo-3-(2,2-dibromoethenyl)-2-ethoxybenzene.
| Compound Name | 1,5-dibromo-3-(2,2-dibromoethenyl)-2-ethoxybenzene |
|---|---|
| PubChem CID | 130532004 |
| Molecular Formula | C10H8Br4O |
| Molecular Weight | 463.79 g/mol |
| Exact Mass | 459.73 |
| IUPAC Name | 1,5-dibromo-3-(2,2-dibromoethenyl)-2-ethoxybenzene |
| SMILES | CCOc1c(Br)cc(Br)cc1C=C(Br)Br |
| InChI | InChI=1S/C10H8Br4O/c1-2-15-10-6(4-9(13)14)3-7(11)5-8(10)12/h3-5H,2H2,1H3 |
| InChIKey | ADXGEMRYYLAOBX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.79 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |