C9H9Br2NO2 — CID 75574757
N-[(3,5-dibromo-2-ethoxyphenyl)methylidene]hydroxylamine (PubChem CID 75574757) has the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-ethoxyphenyl)methylidene]hydroxylamine.
| Compound Name | N-[(3,5-dibromo-2-ethoxyphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 75574757 |
| Molecular Formula | C9H9Br2NO2 |
| Molecular Weight | 322.98 g/mol |
| Exact Mass | 320.90 |
| IUPAC Name | N-[(3,5-dibromo-2-ethoxyphenyl)methylidene]hydroxylamine |
| SMILES | CCOc1c(Br)cc(Br)cc1C=NO |
| InChI | InChI=1S/C9H9Br2NO2/c1-2-14-9-6(5-12-13)3-7(10)4-8(9)11/h3-5,13H,2H2,1H3 |
| InChIKey | AGMOSTFZMJYTMG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.98 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|