C18H17Br2N3O3 — CID 3493462
4-acetamido-N-[(3,5-dibromo-2-ethoxyphenyl)methylideneamino]benzamide (PubChem CID 3493462) has the molecular formula C18H17Br2N3O3 and a molecular weight of 483.16 g/mol. Its IUPAC name is 4-acetamido-N-[(3,5-dibromo-2-ethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-acetamido-N-[(3,5-dibromo-2-ethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 3493462 |
| Molecular Formula | C18H17Br2N3O3 |
| Molecular Weight | 483.16 g/mol |
| Exact Mass | 480.96 |
| IUPAC Name | 4-acetamido-N-[(3,5-dibromo-2-ethoxyphenyl)methylideneamino]benzamide |
| SMILES | CCOc1c(Br)cc(Br)cc1C=NNC(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C18H17Br2N3O3/c1-3-26-17-13(8-14(19)9-16(17)20)10-21-23-18(25)12-4-6-15(7-5-12)22-11(2)24/h4-10H,3H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | UVXHYZWVSUCVSC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.16 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|