C22H15Br2Cl2N3O3 — CID 126262697
4-chloro-N-[(E)-[3,5-dibromo-2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126262697) has the molecular formula C22H15Br2Cl2N3O3 and a molecular weight of 600.09 g/mol. Its IUPAC name is 4-chloro-N-[(E)-[3,5-dibromo-2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(E)-[3,5-dibromo-2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126262697 |
| Molecular Formula | C22H15Br2Cl2N3O3 |
| Molecular Weight | 600.09 g/mol |
| Exact Mass | 596.89 |
| IUPAC Name | 4-chloro-N-[(E)-[3,5-dibromo-2-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | O=C(COc1c(Br)cc(Br)cc1/C=N/NC(=O)c1ccc(Cl)cc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H15Br2Cl2N3O3/c23-15-9-14(11-27-29-22(31)13-5-7-16(25)8-6-13)21(17(24)10-15)32-12-20(30)28-19-4-2-1-3-18(19)26/h1-11H,12H2,(H,28,30)(H,29,31)/b27-11+ |
| InChIKey | LTDWPAUHIRKSHS-LUOAPIJWSA-N |
| XLogP | 6.30 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.09 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|