C15H9Br3Cl2N2O2 — CID 2246193
N-[(2,3-dichlorophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide (PubChem CID 2246193) has the molecular formula C15H9Br3Cl2N2O2 and a molecular weight of 559.87 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide.
| Compound Name | N-[(2,3-dichlorophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
|---|---|
| PubChem CID | 2246193 |
| Molecular Formula | C15H9Br3Cl2N2O2 |
| Molecular Weight | 559.87 g/mol |
| Exact Mass | 555.76 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)NN=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H9Br3Cl2N2O2/c16-9-4-10(17)15(11(18)5-9)24-7-13(23)22-21-6-8-2-1-3-12(19)14(8)20/h1-6H,7H2,(H,22,23) |
| InChIKey | MUOMTNJXHYPPBU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.87 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|