C22H14Br3ClN2O4 — CID 3513116
[4-[[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 3513116) has the molecular formula C22H14Br3ClN2O4 and a molecular weight of 645.53 g/mol. Its IUPAC name is [4-[[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-[[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 3513116 |
| Molecular Formula | C22H14Br3ClN2O4 |
| Molecular Weight | 645.53 g/mol |
| Exact Mass | 641.82 |
| IUPAC Name | [4-[[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)NN=Cc1ccc(OC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H14Br3ClN2O4/c23-14-9-17(24)21(18(25)10-14)31-12-20(29)28-27-11-13-5-7-15(8-6-13)32-22(30)16-3-1-2-4-19(16)26/h1-11H,12H2,(H,28,29) |
| InChIKey | IKXHYDHRTGZPMT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|