C22H16Br3ClN2O3 — CID 135644256
N-[(E)-[5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide (PubChem CID 135644256) has the molecular formula C22H16Br3ClN2O3 and a molecular weight of 631.55 g/mol. Its IUPAC name is N-[(E)-[5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide.
| Compound Name | N-[(E)-[5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
|---|---|
| PubChem CID | 135644256 |
| Molecular Formula | C22H16Br3ClN2O3 |
| Molecular Weight | 631.55 g/mol |
| Exact Mass | 627.84 |
| IUPAC Name | N-[(E)-[5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)N/N=C/c1cc(Cc2ccccc2Cl)ccc1O |
| InChI | InChI=1S/C22H16Br3ClN2O3/c23-16-9-17(24)22(18(25)10-16)31-12-21(30)28-27-11-15-8-13(5-6-20(15)29)7-14-3-1-2-4-19(14)26/h1-6,8-11,29H,7,12H2,(H,28,30)/b27-11+ |
| InChIKey | NQJFDHSKKWCHPW-LUOAPIJWSA-N |
| XLogP | 6.45 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|