C21H16BrClN2O2 — CID 135926012
2-bromo-N-[(Z)-[5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]benzamide (PubChem CID 135926012) has the molecular formula C21H16BrClN2O2 and a molecular weight of 443.73 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-[5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(Z)-[5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135926012 |
| Molecular Formula | C21H16BrClN2O2 |
| Molecular Weight | 443.73 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 2-bromo-N-[(Z)-[5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1cc(Cc2ccccc2Cl)ccc1O)c1ccccc1Br |
| InChI | InChI=1S/C21H16BrClN2O2/c22-18-7-3-2-6-17(18)21(27)25-24-13-16-12-14(9-10-20(16)26)11-15-5-1-4-8-19(15)23/h1-10,12-13,26H,11H2,(H,25,27)/b24-13- |
| InChIKey | RBDSSXKNMMXNBW-CFRMEGHHSA-N |
| XLogP | 5.16 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.73 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|