C17H14Cl3N3O3 — CID 6877054
2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(E)-(2,3-dichlorophenyl)methylideneamino]acetamide (PubChem CID 6877054) has the molecular formula C17H14Cl3N3O3 and a molecular weight of 414.68 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(E)-(2,3-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(E)-(2,3-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6877054 |
| Molecular Formula | C17H14Cl3N3O3 |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | 2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(E)-(2,3-dichlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NCC(=O)N/N=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H14Cl3N3O3/c18-12-4-6-13(7-5-12)26-10-16(25)21-9-15(24)23-22-8-11-2-1-3-14(19)17(11)20/h1-8H,9-10H2,(H,21,25)(H,23,24)/b22-8+ |
| InChIKey | DHYUILUXEXFIBR-GZIVZEMBSA-N |
| XLogP | 3.29 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|