C18H14Cl4N4O2S — CID 171981130
N-[(E)-(2,3-dichlorophenyl)methylideneamino]-2-[2-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanylacetamide (PubChem CID 171981130) has the molecular formula C18H14Cl4N4O2S and a molecular weight of 492.22 g/mol. Its IUPAC name is N-[(E)-(2,3-dichlorophenyl)methylideneamino]-2-[2-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-[(E)-(2,3-dichlorophenyl)methylideneamino]-2-[2-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 171981130 |
| Molecular Formula | C18H14Cl4N4O2S |
| Molecular Weight | 492.22 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | N-[(E)-(2,3-dichlorophenyl)methylideneamino]-2-[2-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanylacetamide |
| SMILES | O=C(CSCC(=O)N/N=C/c1cccc(Cl)c1Cl)N/N=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H14Cl4N4O2S/c19-13-5-1-3-11(17(13)21)7-23-25-15(27)9-29-10-16(28)26-24-8-12-4-2-6-14(20)18(12)22/h1-8H,9-10H2,(H,25,27)(H,26,28)/b23-7+,24-8+ |
| InChIKey | ZANBOZNSCOCTKV-ZPNKGADNSA-N |
| XLogP | 4.63 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.22 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|