C16H15Cl2N3O — CID 872216
N-[(2,3-dichlorophenyl)methylideneamino]-2-(4-methylanilino)acetamide (PubChem CID 872216) has the molecular formula C16H15Cl2N3O and a molecular weight of 336.22 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methylideneamino]-2-(4-methylanilino)acetamide.
| Compound Name | N-[(2,3-dichlorophenyl)methylideneamino]-2-(4-methylanilino)acetamide |
|---|---|
| PubChem CID | 872216 |
| Molecular Formula | C16H15Cl2N3O |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methylideneamino]-2-(4-methylanilino)acetamide |
| SMILES | Cc1ccc(NCC(=O)NN=Cc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2N3O/c1-11-5-7-13(8-6-11)19-10-15(22)21-20-9-12-3-2-4-14(17)16(12)18/h2-9,19H,10H2,1H3,(H,21,22) |
| InChIKey | GZNVRAXQZJYOQJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|