C16H16ClN3O — CID 689465
N-[(4-chlorophenyl)methylideneamino]-2-(4-methylanilino)acetamide (PubChem CID 689465) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methylideneamino]-2-(4-methylanilino)acetamide.
| Compound Name | N-[(4-chlorophenyl)methylideneamino]-2-(4-methylanilino)acetamide |
|---|---|
| PubChem CID | 689465 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-[(4-chlorophenyl)methylideneamino]-2-(4-methylanilino)acetamide |
| SMILES | Cc1ccc(NCC(=O)NN=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H16ClN3O/c1-12-2-8-15(9-3-12)18-11-16(21)20-19-10-13-4-6-14(17)7-5-13/h2-10,18H,11H2,1H3,(H,20,21) |
| InChIKey | ZMNNHMOUNVHZGQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|