C18H23ClN4O — CID 163329045
N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methylanilino)acetamide;hydrochloride (PubChem CID 163329045) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methylanilino)acetamide;hydrochloride.
| Compound Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methylanilino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 163329045 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methylanilino)acetamide;hydrochloride |
| SMILES | Cc1ccc(NCC(=O)N/N=C/c2ccc(N(C)C)cc2)cc1.Cl |
| InChI | InChI=1S/C18H22N4O.ClH/c1-14-4-8-16(9-5-14)19-13-18(23)21-20-12-15-6-10-17(11-7-15)22(2)3;/h4-12,19H,13H2,1-3H3,(H,21,23);1H/b20-12+; |
| InChIKey | AYDSFUXDRFPFGM-BGDWDFROSA-N |
| XLogP | 3.05 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|