C19H24N4O — CID 5403284
(2S)-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methylanilino)propanamide (PubChem CID 5403284) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is (2S)-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methylanilino)propanamide.
| Compound Name | (2S)-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methylanilino)propanamide |
|---|---|
| PubChem CID | 5403284 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (2S)-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-2-(4-methylanilino)propanamide |
| SMILES | Cc1ccc(N[C@@H](C)C(=O)N/N=C\c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H24N4O/c1-14-5-9-17(10-6-14)21-15(2)19(24)22-20-13-16-7-11-18(12-8-16)23(3)4/h5-13,15,21H,1-4H3,(H,22,24)/b20-13-/t15-/m0/s1 |
| InChIKey | ZHMXZYQSTUGZPJ-HYTQYMIGSA-N |
| XLogP | 3.01 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|