C16H15BrClN3O — CID 71960153
2-(4-bromoanilino)-N-[(4-chlorophenyl)methylideneamino]propanamide (PubChem CID 71960153) has the molecular formula C16H15BrClN3O and a molecular weight of 380.67 g/mol. Its IUPAC name is 2-(4-bromoanilino)-N-[(4-chlorophenyl)methylideneamino]propanamide.
| Compound Name | 2-(4-bromoanilino)-N-[(4-chlorophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 71960153 |
| Molecular Formula | C16H15BrClN3O |
| Molecular Weight | 380.67 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 2-(4-bromoanilino)-N-[(4-chlorophenyl)methylideneamino]propanamide |
| SMILES | CC(Nc1ccc(Br)cc1)C(=O)NN=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15BrClN3O/c1-11(20-15-8-4-13(17)5-9-15)16(22)21-19-10-12-2-6-14(18)7-3-12/h2-11,20H,1H3,(H,21,22) |
| InChIKey | GKXMIENZMPOTII-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|