C16H15ClFN3O — CID 40516210
(2R)-2-(4-chloroanilino)-N-[(Z)-(2-fluorophenyl)methylideneamino]propanamide (PubChem CID 40516210) has the molecular formula C16H15ClFN3O and a molecular weight of 319.77 g/mol. Its IUPAC name is (2R)-2-(4-chloroanilino)-N-[(Z)-(2-fluorophenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-(4-chloroanilino)-N-[(Z)-(2-fluorophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 40516210 |
| Molecular Formula | C16H15ClFN3O |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (2R)-2-(4-chloroanilino)-N-[(Z)-(2-fluorophenyl)methylideneamino]propanamide |
| SMILES | C[C@@H](Nc1ccc(Cl)cc1)C(=O)N/N=C\c1ccccc1F |
| InChI | InChI=1S/C16H15ClFN3O/c1-11(20-14-8-6-13(17)7-9-14)16(22)21-19-10-12-4-2-3-5-15(12)18/h2-11,20H,1H3,(H,21,22)/b19-10-/t11-/m1/s1 |
| InChIKey | JQRHDKHIHLZRLX-XEQXHXIFSA-N |
| XLogP | 3.43 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|