C15H16ClN3O2 — CID 2863483
2-(4-chloroanilino)-N-[(5-methylfuran-2-yl)methylideneamino]propanamide (PubChem CID 2863483) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.77 g/mol. Its IUPAC name is 2-(4-chloroanilino)-N-[(5-methylfuran-2-yl)methylideneamino]propanamide.
| Compound Name | 2-(4-chloroanilino)-N-[(5-methylfuran-2-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 2863483 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-(4-chloroanilino)-N-[(5-methylfuran-2-yl)methylideneamino]propanamide |
| SMILES | Cc1ccc(C=NNC(=O)C(C)Nc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C15H16ClN3O2/c1-10-3-8-14(21-10)9-17-19-15(20)11(2)18-13-6-4-12(16)5-7-13/h3-9,11,18H,1-2H3,(H,19,20) |
| InChIKey | ZWQXXXCLEORJTM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|