C15H12Cl2N2O2 — CID 11573346
N-[(E)-(2,3-dichlorophenyl)methylideneamino]-2-(3-hydroxyphenyl)acetamide (PubChem CID 11573346) has the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is N-[(E)-(2,3-dichlorophenyl)methylideneamino]-2-(3-hydroxyphenyl)acetamide.
| Compound Name | N-[(E)-(2,3-dichlorophenyl)methylideneamino]-2-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 11573346 |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | N-[(E)-(2,3-dichlorophenyl)methylideneamino]-2-(3-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1cccc(O)c1)N/N=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H12Cl2N2O2/c16-13-6-2-4-11(15(13)17)9-18-19-14(21)8-10-3-1-5-12(20)7-10/h1-7,9,20H,8H2,(H,19,21)/b18-9+ |
| InChIKey | VPYYRBCZCGTHNW-GIJQJNRQSA-N |
| XLogP | 3.39 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|