C18H17Br2N3O3 — CID 135460589
N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-(2-methylpropanoylamino)benzamide (PubChem CID 135460589) has the molecular formula C18H17Br2N3O3 and a molecular weight of 483.16 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-(2-methylpropanoylamino)benzamide.
| Compound Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 135460589 |
| Molecular Formula | C18H17Br2N3O3 |
| Molecular Weight | 483.16 g/mol |
| Exact Mass | 480.96 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-(2-methylpropanoylamino)benzamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)N/N=C/c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C18H17Br2N3O3/c1-10(2)17(25)22-14-5-3-11(4-6-14)18(26)23-21-9-12-7-13(19)8-15(20)16(12)24/h3-10,24H,1-2H3,(H,22,25)(H,23,26)/b21-9+ |
| InChIKey | NALXJECTZSGYJG-ZVBGSRNCSA-N |
| XLogP | 4.28 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.16 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|