C15H11Br2NO4 — CID 126082413
4-[[2,4-dibromo-6-[(Z)-hydroxyiminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126082413) has the molecular formula C15H11Br2NO4 and a molecular weight of 429.06 g/mol. Its IUPAC name is 4-[[2,4-dibromo-6-[(Z)-hydroxyiminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,4-dibromo-6-[(Z)-hydroxyiminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126082413 |
| Molecular Formula | C15H11Br2NO4 |
| Molecular Weight | 429.06 g/mol |
| Exact Mass | 426.91 |
| IUPAC Name | 4-[[2,4-dibromo-6-[(Z)-hydroxyiminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2c(Br)cc(Br)cc2/C=N\O)cc1 |
| InChI | InChI=1S/C15H11Br2NO4/c16-12-5-11(7-18-21)14(13(17)6-12)22-8-9-1-3-10(4-2-9)15(19)20/h1-7,21H,8H2,(H,19,20)/b18-7- |
| InChIKey | XAUWOCVSOGIOGY-WSVATBPTSA-N |
| XLogP | 4.30 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.06 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|