C23H19Br2NO4 — CID 126206268
4-[[2,4-dibromo-6-[(4-ethoxyphenyl)iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126206268) has the molecular formula C23H19Br2NO4 and a molecular weight of 533.22 g/mol. Its IUPAC name is 4-[[2,4-dibromo-6-[(4-ethoxyphenyl)iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,4-dibromo-6-[(4-ethoxyphenyl)iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126206268 |
| Molecular Formula | C23H19Br2NO4 |
| Molecular Weight | 533.22 g/mol |
| Exact Mass | 530.97 |
| IUPAC Name | 4-[[2,4-dibromo-6-[(4-ethoxyphenyl)iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1ccc(/N=C/c2cc(Br)cc(Br)c2OCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H19Br2NO4/c1-2-29-20-9-7-19(8-10-20)26-13-17-11-18(24)12-21(25)22(17)30-14-15-3-5-16(6-4-15)23(27)28/h3-13H,2,14H2,1H3,(H,27,28)/b26-13+ |
| InChIKey | FWSVIZDIASUAGY-LGJNPRDNSA-N |
| XLogP | 6.64 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.22 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|