C16H13Br2NO3 — CID 1286584
ethyl 4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]benzoate (PubChem CID 1286584) has the molecular formula C16H13Br2NO3 and a molecular weight of 427.09 g/mol. Its IUPAC name is ethyl 4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]benzoate.
| Compound Name | ethyl 4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 1286584 |
| Molecular Formula | C16H13Br2NO3 |
| Molecular Weight | 427.09 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | ethyl 4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C/c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C16H13Br2NO3/c1-2-22-16(21)10-3-5-13(6-4-10)19-9-11-7-12(17)8-14(18)15(11)20/h3-9,20H,2H2,1H3/b19-9+ |
| InChIKey | JYVHDSRUOTWITJ-DJKKODMXSA-N |
| XLogP | 4.84 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.09 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|