C15H12Br2ClNO — CID 581457
N-(4-chlorophenyl)-1-(3,5-dibromo-2-ethoxyphenyl)methanimine (PubChem CID 581457) has the molecular formula C15H12Br2ClNO and a molecular weight of 417.53 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-(3,5-dibromo-2-ethoxyphenyl)methanimine.
| Compound Name | N-(4-chlorophenyl)-1-(3,5-dibromo-2-ethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 581457 |
| Molecular Formula | C15H12Br2ClNO |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 414.90 |
| IUPAC Name | N-(4-chlorophenyl)-1-(3,5-dibromo-2-ethoxyphenyl)methanimine |
| SMILES | CCOc1c(Br)cc(Br)cc1/C=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12Br2ClNO/c1-2-20-15-10(7-11(16)8-14(15)17)9-19-13-5-3-12(18)4-6-13/h3-9H,2H2,1H3/b19-9+ |
| InChIKey | FYXUMUMZHYFSQH-DJKKODMXSA-N |
| XLogP | 6.01 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|