C26H17Br2Cl2NO2 — CID 126215516
1-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(4-phenoxyphenyl)methanimine (PubChem CID 126215516) has the molecular formula C26H17Br2Cl2NO2 and a molecular weight of 606.14 g/mol. Its IUPAC name is 1-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(4-phenoxyphenyl)methanimine.
| Compound Name | 1-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(4-phenoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126215516 |
| Molecular Formula | C26H17Br2Cl2NO2 |
| Molecular Weight | 606.14 g/mol |
| Exact Mass | 602.90 |
| IUPAC Name | 1-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(4-phenoxyphenyl)methanimine |
| SMILES | Clc1ccc(COc2c(Br)cc(Br)cc2/C=N/c2ccc(Oc3ccccc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C26H17Br2Cl2NO2/c27-19-12-18(26(24(28)13-19)32-16-17-6-7-20(29)14-25(17)30)15-31-21-8-10-23(11-9-21)33-22-4-2-1-3-5-22/h1-15H,16H2/b31-15+ |
| InChIKey | FLUNINBGUJSPOE-IBBHUPRXSA-N |
| XLogP | 9.64 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.14 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|