C29H18Br2Cl2N2O2S — CID 5286343
(5E)-5-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 5286343) has the molecular formula C29H18Br2Cl2N2O2S and a molecular weight of 689.26 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5286343 |
| Molecular Formula | C29H18Br2Cl2N2O2S |
| Molecular Weight | 689.26 g/mol |
| Exact Mass | 685.88 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2cc(Br)cc(Br)c2OCc2ccc(Cl)cc2Cl)S/C(=N\c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C29H18Br2Cl2N2O2S/c30-20-13-19(27(24(31)15-20)37-17-18-11-12-21(32)16-25(18)33)14-26-28(36)35(23-9-5-2-6-10-23)29(38-26)34-22-7-3-1-4-8-22/h1-16H,17H2/b26-14+,34-29- |
| InChIKey | DMSYJOYMIWSSKW-WZMRIPMOSA-N |
| XLogP | 9.91 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.26 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|