C24H19BrN2O3S — CID 2262168
(5E)-5-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 2262168) has the molecular formula C24H19BrN2O3S and a molecular weight of 495.40 g/mol. Its IUPAC name is (5E)-5-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2262168 |
| Molecular Formula | C24H19BrN2O3S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | (5E)-5-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(Br)c(/C=C2/S/C(=N\c3ccccc3)N(c3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C24H19BrN2O3S/c1-29-20-13-16(19(25)15-21(20)30-2)14-22-23(28)27(18-11-7-4-8-12-18)24(31-22)26-17-9-5-3-6-10-17/h3-15H,1-2H3/b22-14+,26-24- |
| InChIKey | HPLRRNSDOTUINU-DDOPLPCHSA-N |
| XLogP | 6.27 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|