C27H20N2O2S — CID 22305747
(5E)-5-[(2-methoxynaphthalen-1-yl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 22305747) has the molecular formula C27H20N2O2S and a molecular weight of 436.54 g/mol. Its IUPAC name is (5E)-5-[(2-methoxynaphthalen-1-yl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2-methoxynaphthalen-1-yl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 22305747 |
| Molecular Formula | C27H20N2O2S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (5E)-5-[(2-methoxynaphthalen-1-yl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2ccccc2c1/C=C1/S/C(=N\c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C27H20N2O2S/c1-31-24-17-16-19-10-8-9-15-22(19)23(24)18-25-26(30)29(21-13-6-3-7-14-21)27(32-25)28-20-11-4-2-5-12-20/h2-18H,1H3/b25-18+,28-27- |
| InChIKey | FEMIEZRCXCANGU-AJGXWLHTSA-N |
| XLogP | 6.66 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|