C22H11F5N2OS — CID 56694403
(5Z)-5-[(2,3,4,5,6-pentafluorophenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 56694403) has the molecular formula C22H11F5N2OS and a molecular weight of 446.40 g/mol. Its IUPAC name is (5Z)-5-[(2,3,4,5,6-pentafluorophenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2,3,4,5,6-pentafluorophenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 56694403 |
| Molecular Formula | C22H11F5N2OS |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | (5Z)-5-[(2,3,4,5,6-pentafluorophenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2c(F)c(F)c(F)c(F)c2F)S/C(=N\c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H11F5N2OS/c23-16-14(17(24)19(26)20(27)18(16)25)11-15-21(30)29(13-9-5-2-6-10-13)22(31-15)28-12-7-3-1-4-8-12/h1-11H/b15-11-,28-22- |
| InChIKey | YRJOGAFYKIZWSR-NDBIWCFCSA-N |
| XLogP | 6.19 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|