C26H19N3O2S — CID 126025956
(5Z)-5-[[1-(4-hydroxyphenyl)pyrrol-2-yl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126025956) has the molecular formula C26H19N3O2S and a molecular weight of 437.52 g/mol. Its IUPAC name is (5Z)-5-[[1-(4-hydroxyphenyl)pyrrol-2-yl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-(4-hydroxyphenyl)pyrrol-2-yl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126025956 |
| Molecular Formula | C26H19N3O2S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | (5Z)-5-[[1-(4-hydroxyphenyl)pyrrol-2-yl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cccn2-c2ccc(O)cc2)S/C(=N\c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C26H19N3O2S/c30-23-15-13-20(14-16-23)28-17-7-12-22(28)18-24-25(31)29(21-10-5-2-6-11-21)26(32-24)27-19-8-3-1-4-9-19/h1-18,30H/b24-18-,27-26- |
| InChIKey | RKOPVIFOWSNIPW-DZNDYGJHSA-N |
| XLogP | 5.99 |
| TPSA | 57.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|