C29H21N3O5S — CID 98634099
3-[2-[(Z)-[3-[(4-carboxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoic acid (PubChem CID 98634099) has the molecular formula C29H21N3O5S and a molecular weight of 523.57 g/mol. Its IUPAC name is 3-[2-[(Z)-[3-[(4-carboxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 3-[2-[(Z)-[3-[(4-carboxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 98634099 |
| Molecular Formula | C29H21N3O5S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 3-[2-[(Z)-[3-[(4-carboxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2C(=O)/C(=C/c3cccn3-c3cccc(C(=O)O)c3)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C29H21N3O5S/c33-26-25(17-24-10-5-15-31(24)23-9-4-6-21(16-23)28(36)37)38-29(30-22-7-2-1-3-8-22)32(26)18-19-11-13-20(14-12-19)27(34)35/h1-17H,18H2,(H,34,35)(H,36,37)/b25-17-,30-29- |
| InChIKey | WNDTVRNCPWPHSD-AWMZFSGVSA-N |
| XLogP | 5.68 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|