C29H19F3N2O3S — CID 57408660
4-[[(5Z)-5-(naphthalen-2-ylmethylidene)-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-3-yl]methyl]benzoic acid (PubChem CID 57408660) has the molecular formula C29H19F3N2O3S and a molecular weight of 532.54 g/mol. Its IUPAC name is 4-[[(5Z)-5-(naphthalen-2-ylmethylidene)-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[(5Z)-5-(naphthalen-2-ylmethylidene)-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 57408660 |
| Molecular Formula | C29H19F3N2O3S |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 4-[[(5Z)-5-(naphthalen-2-ylmethylidene)-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2C(=O)/C(=C/c3ccc4ccccc4c3)S/C2=N\c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H19F3N2O3S/c30-29(31,32)23-11-13-24(14-12-23)33-28-34(17-18-5-9-21(10-6-18)27(36)37)26(35)25(38-28)16-19-7-8-20-3-1-2-4-22(20)15-19/h1-16H,17H2,(H,36,37)/b25-16-,33-28- |
| InChIKey | XQGXOXVSAUAUSH-PDBIHYPHSA-N |
| XLogP | 7.36 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|