C19H12F3NO5S — CID 23125147
5-[(Z)-[2,4-dioxo-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxybenzoic acid (PubChem CID 23125147) has the molecular formula C19H12F3NO5S and a molecular weight of 423.37 g/mol. Its IUPAC name is 5-[(Z)-[2,4-dioxo-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[(Z)-[2,4-dioxo-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 23125147 |
| Molecular Formula | C19H12F3NO5S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 5-[(Z)-[2,4-dioxo-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(/C=C2\SC(=O)N(Cc3ccc(C(F)(F)F)cc3)C2=O)ccc1O |
| InChI | InChI=1S/C19H12F3NO5S/c20-19(21,22)12-4-1-10(2-5-12)9-23-16(25)15(29-18(23)28)8-11-3-6-14(24)13(7-11)17(26)27/h1-8,24H,9H2,(H,26,27)/b15-8- |
| InChIKey | MTEACTKIYPFTGT-NVNXTCNLSA-N |
| XLogP | 4.35 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|