C18H12N2O7S — CID 74019884
2-hydroxy-5-[[3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 74019884) has the molecular formula C18H12N2O7S and a molecular weight of 400.37 g/mol. Its IUPAC name is 2-hydroxy-5-[[3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[[3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 74019884 |
| Molecular Formula | C18H12N2O7S |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 2-hydroxy-5-[[3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1cc(C=C2SC(=O)N(Cc3ccc([N+](=O)[O-])cc3)C2=O)ccc1O |
| InChI | InChI=1S/C18H12N2O7S/c21-14-6-3-11(7-13(14)17(23)24)8-15-16(22)19(18(25)28-15)9-10-1-4-12(5-2-10)20(26)27/h1-8,21H,9H2,(H,23,24) |
| InChIKey | DZSZDUKCKIRFDG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|