C17H10I2N2O5S — CID 124668526
(5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124668526) has the molecular formula C17H10I2N2O5S and a molecular weight of 608.15 g/mol. Its IUPAC name is (5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124668526 |
| Molecular Formula | C17H10I2N2O5S |
| Molecular Weight | 608.15 g/mol |
| Exact Mass | 607.84 |
| IUPAC Name | (5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cc(I)c(O)c(I)c2)C(=O)N1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H10I2N2O5S/c18-12-5-10(6-13(19)15(12)22)7-14-16(23)20(17(24)27-14)8-9-1-3-11(4-2-9)21(25)26/h1-7,22H,8H2/b14-7+ |
| InChIKey | NSWJJTZTCVXCRR-VGOFMYFVSA-N |
| XLogP | 4.75 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.15 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|