C17H11N3O7S — CID 4066563
5-[(4-hydroxy-3-nitrophenyl)methylidene]-3-[(3-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 4066563) has the molecular formula C17H11N3O7S and a molecular weight of 401.36 g/mol. Its IUPAC name is 5-[(4-hydroxy-3-nitrophenyl)methylidene]-3-[(3-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(4-hydroxy-3-nitrophenyl)methylidene]-3-[(3-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4066563 |
| Molecular Formula | C17H11N3O7S |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 5-[(4-hydroxy-3-nitrophenyl)methylidene]-3-[(3-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc(O)c([N+](=O)[O-])c2)C(=O)N1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H11N3O7S/c21-14-5-4-10(7-13(14)20(26)27)8-15-16(22)18(17(23)28-15)9-11-2-1-3-12(6-11)19(24)25/h1-8,21H,9H2 |
| InChIKey | MLRDPANLJCFTAT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|