C18H11N3O5S — CID 126179581
2-[[(5E)-5-[(4-hydroxy-3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126179581) has the molecular formula C18H11N3O5S and a molecular weight of 381.37 g/mol. Its IUPAC name is 2-[[(5E)-5-[(4-hydroxy-3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-[(4-hydroxy-3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126179581 |
| Molecular Formula | C18H11N3O5S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 2-[[(5E)-5-[(4-hydroxy-3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1C(=O)S/C(=C/c2ccc(O)c([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C18H11N3O5S/c19-9-12-3-1-2-4-13(12)10-20-17(23)16(27-18(20)24)8-11-5-6-15(22)14(7-11)21(25)26/h1-8,22H,10H2/b16-8+ |
| InChIKey | IIJJQNPIGHPTEH-LZYBPNLTSA-N |
| XLogP | 3.41 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|