C25H16BrN3O5S — CID 126181671
2-[[(5E)-5-[[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126181671) has the molecular formula C25H16BrN3O5S and a molecular weight of 550.39 g/mol. Its IUPAC name is 2-[[(5E)-5-[[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-[[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126181671 |
| Molecular Formula | C25H16BrN3O5S |
| Molecular Weight | 550.39 g/mol |
| Exact Mass | 549.00 |
| IUPAC Name | 2-[[(5E)-5-[[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1C(=O)S/C(=C/c2ccc(OCc3cccc([N+](=O)[O-])c3)c(Br)c2)C1=O |
| InChI | InChI=1S/C25H16BrN3O5S/c26-21-11-16(8-9-22(21)34-15-17-4-3-7-20(10-17)29(32)33)12-23-24(30)28(25(31)35-23)14-19-6-2-1-5-18(19)13-27/h1-12H,14-15H2/b23-12+ |
| InChIKey | YOJNKNUFWRFSEM-FSJBWODESA-N |
| XLogP | 6.04 |
| TPSA | 113.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.39 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|