C25H17BrN2O6S — CID 126393585
methyl 5-[[(5E)-5-[[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 126393585) has the molecular formula C25H17BrN2O6S and a molecular weight of 553.39 g/mol. Its IUPAC name is methyl 5-[[(5E)-5-[[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(5E)-5-[[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126393585 |
| Molecular Formula | C25H17BrN2O6S |
| Molecular Weight | 553.39 g/mol |
| Exact Mass | 552.00 |
| IUPAC Name | methyl 5-[[(5E)-5-[[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C/c3ccc(OCc4ccccc4C#N)c(Br)c3)C2=O)o1 |
| InChI | InChI=1S/C25H17BrN2O6S/c1-32-24(30)21-9-7-18(34-21)13-28-23(29)22(35-25(28)31)11-15-6-8-20(19(26)10-15)33-14-17-5-3-2-4-16(17)12-27/h2-11H,13-14H2,1H3/b22-11+ |
| InChIKey | LHTHENLXUQTEFE-SSDVNMTOSA-N |
| XLogP | 5.52 |
| TPSA | 109.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|