C28H20BrNO6S — CID 126392044
methyl 5-[[(5E)-5-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 126392044) has the molecular formula C28H20BrNO6S and a molecular weight of 578.44 g/mol. Its IUPAC name is methyl 5-[[(5E)-5-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(5E)-5-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126392044 |
| Molecular Formula | C28H20BrNO6S |
| Molecular Weight | 578.44 g/mol |
| Exact Mass | 577.02 |
| IUPAC Name | methyl 5-[[(5E)-5-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C/c3ccc(OCc4ccc5ccccc5c4)c(Br)c3)C2=O)o1 |
| InChI | InChI=1S/C28H20BrNO6S/c1-34-27(32)24-11-9-21(36-24)15-30-26(31)25(37-28(30)33)14-17-7-10-23(22(29)13-17)35-16-18-6-8-19-4-2-3-5-20(19)12-18/h2-14H,15-16H2,1H3/b25-14+ |
| InChIKey | BQVVYXJCUCCEPI-AFUMVMLFSA-N |
| XLogP | 6.80 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.44 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|