C18H11Cl2NO6S — CID 91563841
5-[[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,3-dihydroxybenzoic acid (PubChem CID 91563841) has the molecular formula C18H11Cl2NO6S and a molecular weight of 440.26 g/mol. Its IUPAC name is 5-[[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,3-dihydroxybenzoic acid.
| Compound Name | 5-[[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,3-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 91563841 |
| Molecular Formula | C18H11Cl2NO6S |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 438.97 |
| IUPAC Name | 5-[[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,3-dihydroxybenzoic acid |
| SMILES | O=C(O)c1cc(C=C2SC(=O)N(Cc3ccc(Cl)c(Cl)c3)C2=O)cc(O)c1O |
| InChI | InChI=1S/C18H11Cl2NO6S/c19-11-2-1-8(4-12(11)20)7-21-16(24)14(28-18(21)27)6-9-3-10(17(25)26)15(23)13(22)5-9/h1-6,22-23H,7H2,(H,25,26) |
| InChIKey | HXCMIIZKXQNRRP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|