C19H14Cl2N2O3S — CID 6108915
N-[4-[(Z)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]acetamide (PubChem CID 6108915) has the molecular formula C19H14Cl2N2O3S and a molecular weight of 421.31 g/mol. Its IUPAC name is N-[4-[(Z)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 6108915 |
| Molecular Formula | C19H14Cl2N2O3S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | N-[4-[(Z)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C2\SC(=O)N(Cc3ccc(Cl)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C19H14Cl2N2O3S/c1-11(24)22-14-5-2-12(3-6-14)9-17-18(25)23(19(26)27-17)10-13-4-7-15(20)16(21)8-13/h2-9H,10H2,1H3,(H,22,24)/b17-9- |
| InChIKey | UYVILLSOAXKYGB-MFOYZWKCSA-N |
| XLogP | 5.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|