C22H19Cl2NO4S — CID 87837907
tert-butyl 3-[(E)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 87837907) has the molecular formula C22H19Cl2NO4S and a molecular weight of 464.37 g/mol. Its IUPAC name is tert-butyl 3-[(E)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | tert-butyl 3-[(E)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 87837907 |
| Molecular Formula | C22H19Cl2NO4S |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | tert-butyl 3-[(E)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(/C=C2/SC(=O)N(Cc3ccc(Cl)c(Cl)c3)C2=O)c1 |
| InChI | InChI=1S/C22H19Cl2NO4S/c1-22(2,3)29-20(27)15-6-4-5-13(9-15)11-18-19(26)25(21(28)30-18)12-14-7-8-16(23)17(24)10-14/h4-11H,12H2,1-3H3/b18-11+ |
| InChIKey | GPWBDRYLDNJWKV-WOJGMQOQSA-N |
| XLogP | 6.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|