C30H25ClF3N3O3S — CID 171136421
5-[[4-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]phenyl]methylidene]-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 171136421) has the molecular formula C30H25ClF3N3O3S and a molecular weight of 600.06 g/mol. Its IUPAC name is 5-[[4-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]phenyl]methylidene]-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]phenyl]methylidene]-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 171136421 |
| Molecular Formula | C30H25ClF3N3O3S |
| Molecular Weight | 600.06 g/mol |
| Exact Mass | 599.13 |
| IUPAC Name | 5-[[4-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]phenyl]methylidene]-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(c1ccc(C=C2SC(=O)N(Cc3ccc(C(F)(F)F)cc3)C2=O)cc1)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C30H25ClF3N3O3S/c31-25-11-5-21(6-12-25)18-35-13-15-36(16-14-35)27(38)23-7-1-20(2-8-23)17-26-28(39)37(29(40)41-26)19-22-3-9-24(10-4-22)30(32,33)34/h1-12,17H,13-16,18-19H2 |
| InChIKey | IXNAGJWEJKZRIH-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.06 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|